About N-[6-(2-piperidin-1-yl-1,3-thiazol-5-yl)-2-pyridinyl]pyrazin-2-amine
N-[6-(2-piperidin-1-yl-1,3-thiazol-5-yl)-2-pyridinyl]pyrazin-2-amine (PubChem CID 141154333) has the molecular formula C17H18N6S
and a molecular weight of 338.44 g/mol. Its IUPAC name is N-[6-(2-piperidin-1-yl-1,3-thiazol-5-yl)-2-pyridinyl]pyrazin-2-amine.
Molecular Properties
| Compound Name | N-[6-(2-piperidin-1-yl-1,3-thiazol-5-yl)-2-pyridinyl]pyrazin-2-amine |
| PubChem CID | 141154333 |
| Molecular Formula | C17H18N6S |
| Molecular Weight | 338.44 g/mol |
| Exact Mass | 338.13 |
| IUPAC Name | N-[6-(2-piperidin-1-yl-1,3-thiazol-5-yl)-2-pyridinyl]pyrazin-2-amine |
| SMILES | c1cc(Nc2cnccn2)nc(-c2cnc(N3CCCCC3)s2)c1 |
| InChI | InChI=1S/C17H18N6S/c1-2-9-23(10-3-1)17-20-11-14(24-17)13-5-4-6-15(21-13)22-16-12-18-7-8-19-16/h4-8,11-12H,1-3,9-10H2,(H,19,21,22) |
| InChIKey | UKARTRMCSHOFEW-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 66.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.44 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze N-[6-(2-piperidin-1-yl-1,3-thiazol-5-yl)-2-pyridinyl]pyrazin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[6-(2-piperidin-1-yl-1,3-thiazol-5-yl)-2-pyridinyl]pyrazin-2-amine?
The IUPAC name of N-[6-(2-piperidin-1-yl-1,3-thiazol-5-yl)-2-pyridinyl]pyrazin-2-amine (CID 141154333) is N-[6-(2-piperidin-1-yl-1,3-thiazol-5-yl)-2-pyridinyl]pyrazin-2-amine.
What is the SMILES notation for N-[6-(2-piperidin-1-yl-1,3-thiazol-5-yl)-2-pyridinyl]pyrazin-2-amine?
The canonical SMILES for N-[6-(2-piperidin-1-yl-1,3-thiazol-5-yl)-2-pyridinyl]pyrazin-2-amine is c1cc(Nc2cnccn2)nc(-c2cnc(N3CCCCC3)s2)c1.
What is the InChIKey of N-[6-(2-piperidin-1-yl-1,3-thiazol-5-yl)-2-pyridinyl]pyrazin-2-amine?
The InChIKey is UKARTRMCSHOFEW-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18N6S/c1-2-9-23(10-3-1)17-20-11-14(24-17)13-5-4-6-15(21-13)22-16-12-18-7-8-19-16/h4-8,11-12H,1-3,9-10H2,(H,19,21,22).
What are the key properties of N-[6-(2-piperidin-1-yl-1,3-thiazol-5-yl)-2-pyridinyl]pyrazin-2-amine?
N-[6-(2-piperidin-1-yl-1,3-thiazol-5-yl)-2-pyridinyl]pyrazin-2-amine has a molecular weight of 338.44 g/mol, XLogP of 3.73, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-[6-(2-piperidin-1-yl-1,3-thiazol-5-yl)-2-pyridinyl]pyrazin-2-amine is sourced from PubChem (CID 141154333), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).