1H-pyrazole-5-carbonyl fluoride

C4H3FN2O — CID 141154339

IUPAC1H-pyrazole-5-carbonyl fluoride
SMILESO=C(F)c1ccn[nH]1
InChIInChI=1S/C4H3FN2O/c5-4(8)3-1-2-6-7-3/h1-2H,(H,6,7)
InChIKeyQEQNUDRYPOSFQT-UHFFFAOYSA-N
MW114.08 g/mol
LogP0.52
Rot. Bonds1

About 1H-pyrazole-5-carbonyl fluoride

1H-pyrazole-5-carbonyl fluoride (PubChem CID 141154339) has the molecular formula C4H3FN2O and a molecular weight of 114.08 g/mol. Its IUPAC name is 1H-pyrazole-5-carbonyl fluoride.

Molecular Properties

Compound Name1H-pyrazole-5-carbonyl fluoride
PubChem CID141154339
Molecular FormulaC4H3FN2O
Molecular Weight114.08 g/mol
Exact Mass114.02
IUPAC Name1H-pyrazole-5-carbonyl fluoride
SMILESO=C(F)c1ccn[nH]1
InChIInChI=1S/C4H3FN2O/c5-4(8)3-1-2-6-7-3/h1-2H,(H,6,7)
InChIKeyQEQNUDRYPOSFQT-UHFFFAOYSA-N
XLogP0.52
TPSA45.75 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms8
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500114.08
LogP ≤ 50.52
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}

Analyze 1H-pyrazole-5-carbonyl fluoride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1H-pyrazole-5-carbonyl fluoride?
The IUPAC name of 1H-pyrazole-5-carbonyl fluoride (CID 141154339) is 1H-pyrazole-5-carbonyl fluoride.
What is the SMILES notation for 1H-pyrazole-5-carbonyl fluoride?
The canonical SMILES for 1H-pyrazole-5-carbonyl fluoride is O=C(F)c1ccn[nH]1.
What is the InChIKey of 1H-pyrazole-5-carbonyl fluoride?
The InChIKey is QEQNUDRYPOSFQT-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H3FN2O/c5-4(8)3-1-2-6-7-3/h1-2H,(H,6,7).
What are the key properties of 1H-pyrazole-5-carbonyl fluoride?
1H-pyrazole-5-carbonyl fluoride has a molecular weight of 114.08 g/mol, XLogP of 0.52, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-pyrazole-5-carbonyl fluoride is sourced from PubChem (CID 141154339), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).