About 1-[[(1R,2R)-2-aminocyclohexyl]amino]-2H-pyrrol-5-one;hydrochloride
1-[[(1R,2R)-2-aminocyclohexyl]amino]-2H-pyrrol-5-one;hydrochloride (PubChem CID 141154513) has the molecular formula C10H18ClN3O
and a molecular weight of 231.73 g/mol. Its IUPAC name is 1-[[(1R,2R)-2-aminocyclohexyl]amino]-2H-pyrrol-5-one;hydrochloride.
Molecular Properties
| Compound Name | 1-[[(1R,2R)-2-aminocyclohexyl]amino]-2H-pyrrol-5-one;hydrochloride |
| PubChem CID | 141154513 |
| Molecular Formula | C10H18ClN3O |
| Molecular Weight | 231.73 g/mol |
| Exact Mass | 231.11 |
| IUPAC Name | 1-[[(1R,2R)-2-aminocyclohexyl]amino]-2H-pyrrol-5-one;hydrochloride |
| SMILES | Cl.N[C@@H]1CCCC[C@H]1NN1CC=CC1=O |
| InChI | InChI=1S/C10H17N3O.ClH/c11-8-4-1-2-5-9(8)12-13-7-3-6-10(13)14;/h3,6,8-9,12H,1-2,4-5,7,11H2;1H/t8-,9-;/m1./s1 |
| InChIKey | ZSBCFRQEZZHJIB-VTLYIQCISA-N |
| XLogP | 0.58 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.73 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[[(1R,2R)-2-aminocyclohexyl]amino]-2H-pyrrol-5-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[(1R,2R)-2-aminocyclohexyl]amino]-2H-pyrrol-5-one;hydrochloride?
The IUPAC name of 1-[[(1R,2R)-2-aminocyclohexyl]amino]-2H-pyrrol-5-one;hydrochloride (CID 141154513) is 1-[[(1R,2R)-2-aminocyclohexyl]amino]-2H-pyrrol-5-one;hydrochloride.
What is the SMILES notation for 1-[[(1R,2R)-2-aminocyclohexyl]amino]-2H-pyrrol-5-one;hydrochloride?
The canonical SMILES for 1-[[(1R,2R)-2-aminocyclohexyl]amino]-2H-pyrrol-5-one;hydrochloride is Cl.N[C@@H]1CCCC[C@H]1NN1CC=CC1=O.
What is the InChIKey of 1-[[(1R,2R)-2-aminocyclohexyl]amino]-2H-pyrrol-5-one;hydrochloride?
The InChIKey is ZSBCFRQEZZHJIB-VTLYIQCISA-N. The full InChI is InChI=1S/C10H17N3O.ClH/c11-8-4-1-2-5-9(8)12-13-7-3-6-10(13)14;/h3,6,8-9,12H,1-2,4-5,7,11H2;1H/t8-,9-;/m1./s1.
What are the key properties of 1-[[(1R,2R)-2-aminocyclohexyl]amino]-2H-pyrrol-5-one;hydrochloride?
1-[[(1R,2R)-2-aminocyclohexyl]amino]-2H-pyrrol-5-one;hydrochloride has a molecular weight of 231.73 g/mol, XLogP of 0.58, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[(1R,2R)-2-aminocyclohexyl]amino]-2H-pyrrol-5-one;hydrochloride is sourced from PubChem (CID 141154513), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).