C21H21NO6 — CID 141154852
2-O-tert-butyl 6-O,7-O-dimethyl 9H-indeno[2,1-b]pyridine-2,6,7-tricarboxylate (PubChem CID 141154852) has the molecular formula C21H21NO6 and a molecular weight of 383.40 g/mol. Its IUPAC name is 2-O-tert-butyl 6-O,7-O-dimethyl 9H-indeno[2,1-b]pyridine-2,6,7-tricarboxylate.
| Compound Name | 2-O-tert-butyl 6-O,7-O-dimethyl 9H-indeno[2,1-b]pyridine-2,6,7-tricarboxylate |
|---|---|
| PubChem CID | 141154852 |
| Molecular Formula | C21H21NO6 |
| Molecular Weight | 383.40 g/mol |
| Exact Mass | 383.14 |
| IUPAC Name | 2-O-tert-butyl 6-O,7-O-dimethyl 9H-indeno[2,1-b]pyridine-2,6,7-tricarboxylate |
| SMILES | COC(=O)c1cc2c(cc1C(=O)OC)-c1ccc(C(=O)OC(C)(C)C)nc1C2 |
| InChI | InChI=1S/C21H21NO6/c1-21(2,3)28-20(25)16-7-6-12-13-10-15(19(24)27-5)14(18(23)26-4)8-11(13)9-17(12)22-16/h6-8,10H,9H2,1-5H3 |
| InChIKey | YJBQFVIKTUZAKX-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 91.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.40 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|