2-methyl-3,4-dihydro-2H-pyridine-1-carboxylic acid

C7H11NO2 — CID 141154977

IUPAC2-methyl-3,4-dihydro-2H-pyridine-1-carboxylic acid
SMILESCC1CCC=CN1C(=O)O
InChIInChI=1S/C7H11NO2/c1-6-4-2-3-5-8(6)7(9)10/h3,5-6H,2,4H2,1H3,(H,9,10)
InChIKeySVWFUCUJUKKHAW-UHFFFAOYSA-N
MW141.17 g/mol
LogP1.66
Rot. Bonds

About 2-methyl-3,4-dihydro-2H-pyridine-1-carboxylic acid

2-methyl-3,4-dihydro-2H-pyridine-1-carboxylic acid (PubChem CID 141154977) has the molecular formula C7H11NO2 and a molecular weight of 141.17 g/mol. Its IUPAC name is 2-methyl-3,4-dihydro-2H-pyridine-1-carboxylic acid.

Molecular Properties

Compound Name2-methyl-3,4-dihydro-2H-pyridine-1-carboxylic acid
PubChem CID141154977
Molecular FormulaC7H11NO2
Molecular Weight141.17 g/mol
Exact Mass141.08
IUPAC Name2-methyl-3,4-dihydro-2H-pyridine-1-carboxylic acid
SMILESCC1CCC=CN1C(=O)O
InChIInChI=1S/C7H11NO2/c1-6-4-2-3-5-8(6)7(9)10/h3,5-6H,2,4H2,1H3,(H,9,10)
InChIKeySVWFUCUJUKKHAW-UHFFFAOYSA-N
XLogP1.66
TPSA40.54 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds
Heavy Atoms10
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500141.17
LogP ≤ 51.66
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Analyze 2-methyl-3,4-dihydro-2H-pyridine-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-methyl-3,4-dihydro-2H-pyridine-1-carboxylic acid?
The IUPAC name of 2-methyl-3,4-dihydro-2H-pyridine-1-carboxylic acid (CID 141154977) is 2-methyl-3,4-dihydro-2H-pyridine-1-carboxylic acid.
What is the SMILES notation for 2-methyl-3,4-dihydro-2H-pyridine-1-carboxylic acid?
The canonical SMILES for 2-methyl-3,4-dihydro-2H-pyridine-1-carboxylic acid is CC1CCC=CN1C(=O)O.
What is the InChIKey of 2-methyl-3,4-dihydro-2H-pyridine-1-carboxylic acid?
The InChIKey is SVWFUCUJUKKHAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11NO2/c1-6-4-2-3-5-8(6)7(9)10/h3,5-6H,2,4H2,1H3,(H,9,10).
What are the key properties of 2-methyl-3,4-dihydro-2H-pyridine-1-carboxylic acid?
2-methyl-3,4-dihydro-2H-pyridine-1-carboxylic acid has a molecular weight of 141.17 g/mol, XLogP of 1.66, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-3,4-dihydro-2H-pyridine-1-carboxylic acid is sourced from PubChem (CID 141154977), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).