About 1-bicyclo[2.2.1]heptanyl hypochlorite
1-bicyclo[2.2.1]heptanyl hypochlorite (PubChem CID 141155008) has the molecular formula C7H11ClO
and a molecular weight of 146.62 g/mol. Its IUPAC name is 1-bicyclo[2.2.1]heptanyl hypochlorite.
Molecular Properties
| Compound Name | 1-bicyclo[2.2.1]heptanyl hypochlorite |
| PubChem CID | 141155008 |
| Molecular Formula | C7H11ClO |
| Molecular Weight | 146.62 g/mol |
| Exact Mass | 146.05 |
| IUPAC Name | 1-bicyclo[2.2.1]heptanyl hypochlorite |
| SMILES | ClOC12CCC(CC1)C2 |
| InChI | InChI=1S/C7H11ClO/c8-9-7-3-1-6(5-7)2-4-7/h6H,1-5H2 |
| InChIKey | YVVQLVBGLJKYQZ-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.62 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-bicyclo[2.2.1]heptanyl hypochlorite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bicyclo[2.2.1]heptanyl hypochlorite?
The IUPAC name of 1-bicyclo[2.2.1]heptanyl hypochlorite (CID 141155008) is 1-bicyclo[2.2.1]heptanyl hypochlorite.
What is the SMILES notation for 1-bicyclo[2.2.1]heptanyl hypochlorite?
The canonical SMILES for 1-bicyclo[2.2.1]heptanyl hypochlorite is ClOC12CCC(CC1)C2.
What is the InChIKey of 1-bicyclo[2.2.1]heptanyl hypochlorite?
The InChIKey is YVVQLVBGLJKYQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11ClO/c8-9-7-3-1-6(5-7)2-4-7/h6H,1-5H2.
What are the key properties of 1-bicyclo[2.2.1]heptanyl hypochlorite?
1-bicyclo[2.2.1]heptanyl hypochlorite has a molecular weight of 146.62 g/mol, XLogP of 2.49, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bicyclo[2.2.1]heptanyl hypochlorite is sourced from PubChem (CID 141155008), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).