C31H64O6 — CID 141155229
2-butoxy-1-(2,2-dimethylpropoxy)-1-hexylperoxy-4-methyl-1-(3-methylbutoxy)-2-pentoxypentane (PubChem CID 141155229) has the molecular formula C31H64O6 and a molecular weight of 532.85 g/mol. Its IUPAC name is 2-butoxy-1-(2,2-dimethylpropoxy)-1-hexylperoxy-4-methyl-1-(3-methylbutoxy)-2-pentoxypentane.
| Compound Name | 2-butoxy-1-(2,2-dimethylpropoxy)-1-hexylperoxy-4-methyl-1-(3-methylbutoxy)-2-pentoxypentane |
|---|---|
| PubChem CID | 141155229 |
| Molecular Formula | C31H64O6 |
| Molecular Weight | 532.85 g/mol |
| Exact Mass | 532.47 |
| IUPAC Name | 2-butoxy-1-(2,2-dimethylpropoxy)-1-hexylperoxy-4-methyl-1-(3-methylbutoxy)-2-pentoxypentane |
| SMILES | CCCCCCOOC(OCCC(C)C)(OCC(C)(C)C)C(CC(C)C)(OCCCC)OCCCCC |
| InChI | InChI=1S/C31H64O6/c1-11-14-17-19-23-36-37-31(34-24-20-27(4)5,35-26-29(8,9)10)30(25-28(6)7,32-21-16-13-3)33-22-18-15-12-2/h27-28H,11-26H2,1-10H3 |
| InChIKey | XPNZGGNNBNSBLD-UHFFFAOYSA-N |
| XLogP | 9.06 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.85 |
| LogP ≤ 5 | 9.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|