C13H16N2O2S — CID 141155328
5-ethylsulfonyl-1,2,3,4-tetrahydropyrido[4,3-b]indole (PubChem CID 141155328) has the molecular formula C13H16N2O2S and a molecular weight of 264.35 g/mol. Its IUPAC name is 5-ethylsulfonyl-1,2,3,4-tetrahydropyrido[4,3-b]indole.
| Compound Name | 5-ethylsulfonyl-1,2,3,4-tetrahydropyrido[4,3-b]indole |
|---|---|
| PubChem CID | 141155328 |
| Molecular Formula | C13H16N2O2S |
| Molecular Weight | 264.35 g/mol |
| Exact Mass | 264.09 |
| IUPAC Name | 5-ethylsulfonyl-1,2,3,4-tetrahydropyrido[4,3-b]indole |
| SMILES | CCS(=O)(=O)n1c2c(c3ccccc31)CNCC2 |
| InChI | InChI=1S/C13H16N2O2S/c1-2-18(16,17)15-12-6-4-3-5-10(12)11-9-14-8-7-13(11)15/h3-6,14H,2,7-9H2,1H3 |
| InChIKey | WZFXAYSALDRZEZ-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.35 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |