C25H26N2O5 — CID 141155437
1-N,3-N-bis(2-ethoxyphenyl)-4-methoxybenzene-1,3-dicarboxamide (PubChem CID 141155437) has the molecular formula C25H26N2O5 and a molecular weight of 434.49 g/mol. Its IUPAC name is 1-N,3-N-bis(2-ethoxyphenyl)-4-methoxybenzene-1,3-dicarboxamide.
| Compound Name | 1-N,3-N-bis(2-ethoxyphenyl)-4-methoxybenzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 141155437 |
| Molecular Formula | C25H26N2O5 |
| Molecular Weight | 434.49 g/mol |
| Exact Mass | 434.18 |
| IUPAC Name | 1-N,3-N-bis(2-ethoxyphenyl)-4-methoxybenzene-1,3-dicarboxamide |
| SMILES | CCOc1ccccc1NC(=O)c1ccc(OC)c(C(=O)Nc2ccccc2OCC)c1 |
| InChI | InChI=1S/C25H26N2O5/c1-4-31-22-12-8-6-10-19(22)26-24(28)17-14-15-21(30-3)18(16-17)25(29)27-20-11-7-9-13-23(20)32-5-2/h6-16H,4-5H2,1-3H3,(H,26,28)(H,27,29) |
| InChIKey | PEVMPLNKOQECSN-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.49 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |