About 4-[(4-amino-2,6-dimethylphenyl)methyl]-2-[(4-fluorophenyl)methyl]phenol
4-[(4-amino-2,6-dimethylphenyl)methyl]-2-[(4-fluorophenyl)methyl]phenol (PubChem CID 141155753) has the molecular formula C22H22FNO
and a molecular weight of 335.42 g/mol. Its IUPAC name is 4-[(4-amino-2,6-dimethylphenyl)methyl]-2-[(4-fluorophenyl)methyl]phenol.
Molecular Properties
| Compound Name | 4-[(4-amino-2,6-dimethylphenyl)methyl]-2-[(4-fluorophenyl)methyl]phenol |
| PubChem CID | 141155753 |
| Molecular Formula | C22H22FNO |
| Molecular Weight | 335.42 g/mol |
| Exact Mass | 335.17 |
| IUPAC Name | 4-[(4-amino-2,6-dimethylphenyl)methyl]-2-[(4-fluorophenyl)methyl]phenol |
| SMILES | Cc1cc(N)cc(C)c1Cc1ccc(O)c(Cc2ccc(F)cc2)c1 |
| InChI | InChI=1S/C22H22FNO/c1-14-9-20(24)10-15(2)21(14)13-17-5-8-22(25)18(12-17)11-16-3-6-19(23)7-4-16/h3-10,12,25H,11,13,24H2,1-2H3 |
| InChIKey | OEBUPXIADHOFBS-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.42 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-[(4-amino-2,6-dimethylphenyl)methyl]-2-[(4-fluorophenyl)methyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(4-amino-2,6-dimethylphenyl)methyl]-2-[(4-fluorophenyl)methyl]phenol?
The IUPAC name of 4-[(4-amino-2,6-dimethylphenyl)methyl]-2-[(4-fluorophenyl)methyl]phenol (CID 141155753) is 4-[(4-amino-2,6-dimethylphenyl)methyl]-2-[(4-fluorophenyl)methyl]phenol.
What is the SMILES notation for 4-[(4-amino-2,6-dimethylphenyl)methyl]-2-[(4-fluorophenyl)methyl]phenol?
The canonical SMILES for 4-[(4-amino-2,6-dimethylphenyl)methyl]-2-[(4-fluorophenyl)methyl]phenol is Cc1cc(N)cc(C)c1Cc1ccc(O)c(Cc2ccc(F)cc2)c1.
What is the InChIKey of 4-[(4-amino-2,6-dimethylphenyl)methyl]-2-[(4-fluorophenyl)methyl]phenol?
The InChIKey is OEBUPXIADHOFBS-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H22FNO/c1-14-9-20(24)10-15(2)21(14)13-17-5-8-22(25)18(12-17)11-16-3-6-19(23)7-4-16/h3-10,12,25H,11,13,24H2,1-2H3.
What are the key properties of 4-[(4-amino-2,6-dimethylphenyl)methyl]-2-[(4-fluorophenyl)methyl]phenol?
4-[(4-amino-2,6-dimethylphenyl)methyl]-2-[(4-fluorophenyl)methyl]phenol has a molecular weight of 335.42 g/mol, XLogP of 4.91, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(4-amino-2,6-dimethylphenyl)methyl]-2-[(4-fluorophenyl)methyl]phenol is sourced from PubChem (CID 141155753), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).