C25H32N2O2 — CID 141155801
5-[2-[(5,6-diethyl-2,3-dihydro-1H-inden-2-yl)amino]-1-hydroxyethyl]-3-methyl-1,2-dihydroquinolin-8-ol (PubChem CID 141155801) has the molecular formula C25H32N2O2 and a molecular weight of 392.54 g/mol. Its IUPAC name is 5-[2-[(5,6-diethyl-2,3-dihydro-1H-inden-2-yl)amino]-1-hydroxyethyl]-3-methyl-1,2-dihydroquinolin-8-ol.
| Compound Name | 5-[2-[(5,6-diethyl-2,3-dihydro-1H-inden-2-yl)amino]-1-hydroxyethyl]-3-methyl-1,2-dihydroquinolin-8-ol |
|---|---|
| PubChem CID | 141155801 |
| Molecular Formula | C25H32N2O2 |
| Molecular Weight | 392.54 g/mol |
| Exact Mass | 392.25 |
| IUPAC Name | 5-[2-[(5,6-diethyl-2,3-dihydro-1H-inden-2-yl)amino]-1-hydroxyethyl]-3-methyl-1,2-dihydroquinolin-8-ol |
| SMILES | CCc1cc2c(cc1CC)CC(NCC(O)c1ccc(O)c3c1C=C(C)CN3)C2 |
| InChI | InChI=1S/C25H32N2O2/c1-4-16-9-18-11-20(12-19(18)10-17(16)5-2)26-14-24(29)21-6-7-23(28)25-22(21)8-15(3)13-27-25/h6-10,20,24,26-29H,4-5,11-14H2,1-3H3 |
| InChIKey | XHXWUIWEKRJWKM-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 64.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.54 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|