C14H11F17 — CID 141156186
6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,13-heptadecafluoro-3-methyltridec-2-ene (PubChem CID 141156186) has the molecular formula C14H11F17 and a molecular weight of 502.21 g/mol. Its IUPAC name is 6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,13-heptadecafluoro-3-methyltridec-2-ene.
| Compound Name | 6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,13-heptadecafluoro-3-methyltridec-2-ene |
|---|---|
| PubChem CID | 141156186 |
| Molecular Formula | C14H11F17 |
| Molecular Weight | 502.21 g/mol |
| Exact Mass | 502.06 |
| IUPAC Name | 6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,13-heptadecafluoro-3-methyltridec-2-ene |
| SMILES | CC=C(C)CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C14H11F17/c1-3-6(2)4-5-7(15,16)8(17,18)9(19,20)10(21,22)11(23,24)12(25,26)13(27,28)14(29,30)31/h3H,4-5H2,1-2H3 |
| InChIKey | XMUSXHLLDNREJA-UHFFFAOYSA-N |
| XLogP | 7.74 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.21 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|