About tributyl-[(E)-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-enyl]stannane
tributyl-[(E)-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-enyl]stannane (PubChem CID 14115624) has the molecular formula C20H40O2Sn
and a molecular weight of 431.25 g/mol. Its IUPAC name is tributyl-[(E)-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-enyl]stannane.
Molecular Properties
| Compound Name | tributyl-[(E)-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-enyl]stannane |
| PubChem CID | 14115624 |
| Molecular Formula | C20H40O2Sn |
| Molecular Weight | 431.25 g/mol |
| Exact Mass | 432.21 |
| IUPAC Name | tributyl-[(E)-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-enyl]stannane |
| SMILES | CCCC[Sn](C/C=C/[C@H]1COC(C)(C)O1)(CCCC)CCCC |
| InChI | InChI=1S/C8H13O2.3C4H9.Sn/c1-4-5-7-6-9-8(2,3)10-7;3*1-3-4-2;/h4-5,7H,1,6H2,2-3H3;3*1,3-4H2,2H3;/b5-4+;;;;/t7-;;;;/m0..../s1 |
| InChIKey | KNKHUKIDFNVYGC-DOTIGTDBSA-N |
| XLogP | 6.54 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 431.25 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze tributyl-[(E)-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-enyl]stannane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tributyl-[(E)-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-enyl]stannane?
The IUPAC name of tributyl-[(E)-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-enyl]stannane (CID 14115624) is tributyl-[(E)-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-enyl]stannane.
What is the SMILES notation for tributyl-[(E)-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-enyl]stannane?
The canonical SMILES for tributyl-[(E)-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-enyl]stannane is CCCC[Sn](C/C=C/[C@H]1COC(C)(C)O1)(CCCC)CCCC.
What is the InChIKey of tributyl-[(E)-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-enyl]stannane?
The InChIKey is KNKHUKIDFNVYGC-DOTIGTDBSA-N. The full InChI is InChI=1S/C8H13O2.3C4H9.Sn/c1-4-5-7-6-9-8(2,3)10-7;3*1-3-4-2;/h4-5,7H,1,6H2,2-3H3;3*1,3-4H2,2H3;/b5-4+;;;;/t7-;;;;/m0..../s1.
What are the key properties of tributyl-[(E)-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-enyl]stannane?
tributyl-[(E)-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-enyl]stannane has a molecular weight of 431.25 g/mol, XLogP of 6.54, 12 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for tributyl-[(E)-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-enyl]stannane is sourced from PubChem (CID 14115624), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).