C10H10FN3O3S — CID 141156542
(3R)-3-(4-amino-3H-thieno[3,4-d][1,2]oxazol-2-yl)-3-fluoropiperidine-2,6-dione (PubChem CID 141156542) has the molecular formula C10H10FN3O3S and a molecular weight of 271.27 g/mol. Its IUPAC name is (3R)-3-(4-amino-3H-thieno[3,4-d][1,2]oxazol-2-yl)-3-fluoropiperidine-2,6-dione.
| Compound Name | (3R)-3-(4-amino-3H-thieno[3,4-d][1,2]oxazol-2-yl)-3-fluoropiperidine-2,6-dione |
|---|---|
| PubChem CID | 141156542 |
| Molecular Formula | C10H10FN3O3S |
| Molecular Weight | 271.27 g/mol |
| Exact Mass | 271.04 |
| IUPAC Name | (3R)-3-(4-amino-3H-thieno[3,4-d][1,2]oxazol-2-yl)-3-fluoropiperidine-2,6-dione |
| SMILES | Nc1scc2c1CN([C@@]1(F)CCC(=O)NC1=O)O2 |
| InChI | InChI=1S/C10H10FN3O3S/c11-10(2-1-7(15)13-9(10)16)14-3-5-6(17-14)4-18-8(5)12/h4H,1-3,12H2,(H,13,15,16)/t10-/m0/s1 |
| InChIKey | LQDGDFRFFLGEMQ-JTQLQIEISA-N |
| XLogP | 0.54 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.27 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|