C13H17N3O3S — CID 141156645
3-[4-(ethylamino)-3H-thieno[3,4-d][1,2]oxazol-2-yl]-3-methylpiperidine-2,6-dione (PubChem CID 141156645) has the molecular formula C13H17N3O3S and a molecular weight of 295.36 g/mol. Its IUPAC name is 3-[4-(ethylamino)-3H-thieno[3,4-d][1,2]oxazol-2-yl]-3-methylpiperidine-2,6-dione.
| Compound Name | 3-[4-(ethylamino)-3H-thieno[3,4-d][1,2]oxazol-2-yl]-3-methylpiperidine-2,6-dione |
|---|---|
| PubChem CID | 141156645 |
| Molecular Formula | C13H17N3O3S |
| Molecular Weight | 295.36 g/mol |
| Exact Mass | 295.10 |
| IUPAC Name | 3-[4-(ethylamino)-3H-thieno[3,4-d][1,2]oxazol-2-yl]-3-methylpiperidine-2,6-dione |
| SMILES | CCNc1scc2c1CN(C1(C)CCC(=O)NC1=O)O2 |
| InChI | InChI=1S/C13H17N3O3S/c1-3-14-11-8-6-16(19-9(8)7-20-11)13(2)5-4-10(17)15-12(13)18/h7,14H,3-6H2,1-2H3,(H,15,17,18) |
| InChIKey | WHFAPLBACZAMHZ-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.36 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|