About 3H-indene-5-carbonitrile
3H-indene-5-carbonitrile (PubChem CID 141156739) has the molecular formula C10H7N
and a molecular weight of 141.17 g/mol. Its IUPAC name is 3H-indene-5-carbonitrile.
Molecular Properties
| Compound Name | 3H-indene-5-carbonitrile |
| PubChem CID | 141156739 |
| Molecular Formula | C10H7N |
| Molecular Weight | 141.17 g/mol |
| Exact Mass | 141.06 |
| IUPAC Name | 3H-indene-5-carbonitrile |
| SMILES | N#Cc1ccc2c(c1)CC=C2 |
| InChI | InChI=1S/C10H7N/c11-7-8-4-5-9-2-1-3-10(9)6-8/h1-2,4-6H,3H2 |
| InChIKey | INWWRZCPJTXWHT-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.17 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3H-indene-5-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3H-indene-5-carbonitrile?
The IUPAC name of 3H-indene-5-carbonitrile (CID 141156739) is 3H-indene-5-carbonitrile.
What is the SMILES notation for 3H-indene-5-carbonitrile?
The canonical SMILES for 3H-indene-5-carbonitrile is N#Cc1ccc2c(c1)CC=C2.
What is the InChIKey of 3H-indene-5-carbonitrile?
The InChIKey is INWWRZCPJTXWHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7N/c11-7-8-4-5-9-2-1-3-10(9)6-8/h1-2,4-6H,3H2.
What are the key properties of 3H-indene-5-carbonitrile?
3H-indene-5-carbonitrile has a molecular weight of 141.17 g/mol, XLogP of 2.13, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3H-indene-5-carbonitrile is sourced from PubChem (CID 141156739), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).