C9H17O13P — CID 141156822
phosphono 2-[(2R,3R,5S,6R)-1,2,3,4,5,6-hexahydroxycyclohexyl]-2,3-dihydroxypropanoate (PubChem CID 141156822) has the molecular formula C9H17O13P and a molecular weight of 364.20 g/mol. Its IUPAC name is phosphono 2-[(2R,3R,5S,6R)-1,2,3,4,5,6-hexahydroxycyclohexyl]-2,3-dihydroxypropanoate.
| Compound Name | phosphono 2-[(2R,3R,5S,6R)-1,2,3,4,5,6-hexahydroxycyclohexyl]-2,3-dihydroxypropanoate |
|---|---|
| PubChem CID | 141156822 |
| Molecular Formula | C9H17O13P |
| Molecular Weight | 364.20 g/mol |
| Exact Mass | 364.04 |
| IUPAC Name | phosphono 2-[(2R,3R,5S,6R)-1,2,3,4,5,6-hexahydroxycyclohexyl]-2,3-dihydroxypropanoate |
| SMILES | O=C(OP(=O)(O)O)C(O)(CO)C1(O)[C@H](O)[C@H](O)C(O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C9H17O13P/c10-1-8(17,7(16)22-23(19,20)21)9(18)5(14)3(12)2(11)4(13)6(9)15/h2-6,10-15,17-18H,1H2,(H2,19,20,21)/t2?,3-,4+,5-,6-,8?,9?/m1/s1 |
| InChIKey | GSLSKZZGQOIKRZ-UBADWUOZSA-N |
| XLogP | -6.11 |
| TPSA | 245.67 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.20 |
| LogP ≤ 5 | -6.11 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|