About 3-[diphenyl-[(Z)-2-(1,3-thiazol-2-yl)ethenyl]sulfanylmethyl]benzamide
3-[diphenyl-[(Z)-2-(1,3-thiazol-2-yl)ethenyl]sulfanylmethyl]benzamide (PubChem CID 141157805) has the molecular formula C25H20N2OS2
and a molecular weight of 428.58 g/mol. Its IUPAC name is 3-[diphenyl-[(Z)-2-(1,3-thiazol-2-yl)ethenyl]sulfanylmethyl]benzamide.
Molecular Properties
| Compound Name | 3-[diphenyl-[(Z)-2-(1,3-thiazol-2-yl)ethenyl]sulfanylmethyl]benzamide |
| PubChem CID | 141157805 |
| Molecular Formula | C25H20N2OS2 |
| Molecular Weight | 428.58 g/mol |
| Exact Mass | 428.10 |
| IUPAC Name | 3-[diphenyl-[(Z)-2-(1,3-thiazol-2-yl)ethenyl]sulfanylmethyl]benzamide |
| SMILES | NC(=O)c1cccc(C(S/C=C\c2nccs2)(c2ccccc2)c2ccccc2)c1 |
| InChI | InChI=1S/C25H20N2OS2/c26-24(28)19-8-7-13-22(18-19)25(20-9-3-1-4-10-20,21-11-5-2-6-12-21)30-16-14-23-27-15-17-29-23/h1-18H,(H2,26,28)/b16-14- |
| InChIKey | YPBFUBJUQMGHAG-PEZBUJJGSA-N |
| XLogP | 5.94 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 428.58 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze 3-[diphenyl-[(Z)-2-(1,3-thiazol-2-yl)ethenyl]sulfanylmethyl]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[diphenyl-[(Z)-2-(1,3-thiazol-2-yl)ethenyl]sulfanylmethyl]benzamide?
The IUPAC name of 3-[diphenyl-[(Z)-2-(1,3-thiazol-2-yl)ethenyl]sulfanylmethyl]benzamide (CID 141157805) is 3-[diphenyl-[(Z)-2-(1,3-thiazol-2-yl)ethenyl]sulfanylmethyl]benzamide.
What is the SMILES notation for 3-[diphenyl-[(Z)-2-(1,3-thiazol-2-yl)ethenyl]sulfanylmethyl]benzamide?
The canonical SMILES for 3-[diphenyl-[(Z)-2-(1,3-thiazol-2-yl)ethenyl]sulfanylmethyl]benzamide is NC(=O)c1cccc(C(S/C=C\c2nccs2)(c2ccccc2)c2ccccc2)c1.
What is the InChIKey of 3-[diphenyl-[(Z)-2-(1,3-thiazol-2-yl)ethenyl]sulfanylmethyl]benzamide?
The InChIKey is YPBFUBJUQMGHAG-PEZBUJJGSA-N. The full InChI is InChI=1S/C25H20N2OS2/c26-24(28)19-8-7-13-22(18-19)25(20-9-3-1-4-10-20,21-11-5-2-6-12-21)30-16-14-23-27-15-17-29-23/h1-18H,(H2,26,28)/b16-14-.
What are the key properties of 3-[diphenyl-[(Z)-2-(1,3-thiazol-2-yl)ethenyl]sulfanylmethyl]benzamide?
3-[diphenyl-[(Z)-2-(1,3-thiazol-2-yl)ethenyl]sulfanylmethyl]benzamide has a molecular weight of 428.58 g/mol, XLogP of 5.94, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[diphenyl-[(Z)-2-(1,3-thiazol-2-yl)ethenyl]sulfanylmethyl]benzamide is sourced from PubChem (CID 141157805), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).