About 2-butoxy-5-nitrophenol
2-butoxy-5-nitrophenol (PubChem CID 141158099) has the molecular formula C10H13NO4
and a molecular weight of 211.22 g/mol. Its IUPAC name is 2-butoxy-5-nitrophenol.
Molecular Properties
| Compound Name | 2-butoxy-5-nitrophenol |
| PubChem CID | 141158099 |
| Molecular Formula | C10H13NO4 |
| Molecular Weight | 211.22 g/mol |
| Exact Mass | 211.08 |
| IUPAC Name | 2-butoxy-5-nitrophenol |
| SMILES | CCCCOc1ccc([N+](=O)[O-])cc1O |
| InChI | InChI=1S/C10H13NO4/c1-2-3-6-15-10-5-4-8(11(13)14)7-9(10)12/h4-5,7,12H,2-3,6H2,1H3 |
| InChIKey | QUSAZPBBDGIVFX-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 72.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.22 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-butoxy-5-nitrophenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butoxy-5-nitrophenol?
The IUPAC name of 2-butoxy-5-nitrophenol (CID 141158099) is 2-butoxy-5-nitrophenol.
What is the SMILES notation for 2-butoxy-5-nitrophenol?
The canonical SMILES for 2-butoxy-5-nitrophenol is CCCCOc1ccc([N+](=O)[O-])cc1O.
What is the InChIKey of 2-butoxy-5-nitrophenol?
The InChIKey is QUSAZPBBDGIVFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO4/c1-2-3-6-15-10-5-4-8(11(13)14)7-9(10)12/h4-5,7,12H,2-3,6H2,1H3.
What are the key properties of 2-butoxy-5-nitrophenol?
2-butoxy-5-nitrophenol has a molecular weight of 211.22 g/mol, XLogP of 2.48, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butoxy-5-nitrophenol is sourced from PubChem (CID 141158099), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).