About 9-(3,4-dihydro-2H-pyran-4-yl)-2-(5-methylsulfonylbenzimidazol-1-yl)-7H-purin-8-one
9-(3,4-dihydro-2H-pyran-4-yl)-2-(5-methylsulfonylbenzimidazol-1-yl)-7H-purin-8-one (PubChem CID 141158634) has the molecular formula C18H16N6O4S
and a molecular weight of 412.43 g/mol. Its IUPAC name is 9-(3,4-dihydro-2H-pyran-4-yl)-2-(5-methylsulfonylbenzimidazol-1-yl)-7H-purin-8-one.
Molecular Properties
| Compound Name | 9-(3,4-dihydro-2H-pyran-4-yl)-2-(5-methylsulfonylbenzimidazol-1-yl)-7H-purin-8-one |
| PubChem CID | 141158634 |
| Molecular Formula | C18H16N6O4S |
| Molecular Weight | 412.43 g/mol |
| Exact Mass | 412.10 |
| IUPAC Name | 9-(3,4-dihydro-2H-pyran-4-yl)-2-(5-methylsulfonylbenzimidazol-1-yl)-7H-purin-8-one |
| SMILES | CS(=O)(=O)c1ccc2c(c1)ncn2-c1ncc2[nH]c(=O)n(C3C=COCC3)c2n1 |
| InChI | InChI=1S/C18H16N6O4S/c1-29(26,27)12-2-3-15-13(8-12)20-10-23(15)17-19-9-14-16(22-17)24(18(25)21-14)11-4-6-28-7-5-11/h2-4,6,8-11H,5,7H2,1H3,(H,21,25) |
| InChIKey | OTQMZBCVUZJMND-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 124.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 412.43 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
Analyze 9-(3,4-dihydro-2H-pyran-4-yl)-2-(5-methylsulfonylbenzimidazol-1-yl)-7H-purin-8-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-(3,4-dihydro-2H-pyran-4-yl)-2-(5-methylsulfonylbenzimidazol-1-yl)-7H-purin-8-one?
The IUPAC name of 9-(3,4-dihydro-2H-pyran-4-yl)-2-(5-methylsulfonylbenzimidazol-1-yl)-7H-purin-8-one (CID 141158634) is 9-(3,4-dihydro-2H-pyran-4-yl)-2-(5-methylsulfonylbenzimidazol-1-yl)-7H-purin-8-one.
What is the SMILES notation for 9-(3,4-dihydro-2H-pyran-4-yl)-2-(5-methylsulfonylbenzimidazol-1-yl)-7H-purin-8-one?
The canonical SMILES for 9-(3,4-dihydro-2H-pyran-4-yl)-2-(5-methylsulfonylbenzimidazol-1-yl)-7H-purin-8-one is CS(=O)(=O)c1ccc2c(c1)ncn2-c1ncc2[nH]c(=O)n(C3C=COCC3)c2n1.
What is the InChIKey of 9-(3,4-dihydro-2H-pyran-4-yl)-2-(5-methylsulfonylbenzimidazol-1-yl)-7H-purin-8-one?
The InChIKey is OTQMZBCVUZJMND-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16N6O4S/c1-29(26,27)12-2-3-15-13(8-12)20-10-23(15)17-19-9-14-16(22-17)24(18(25)21-14)11-4-6-28-7-5-11/h2-4,6,8-11H,5,7H2,1H3,(H,21,25).
What are the key properties of 9-(3,4-dihydro-2H-pyran-4-yl)-2-(5-methylsulfonylbenzimidazol-1-yl)-7H-purin-8-one?
9-(3,4-dihydro-2H-pyran-4-yl)-2-(5-methylsulfonylbenzimidazol-1-yl)-7H-purin-8-one has a molecular weight of 412.43 g/mol, XLogP of 1.34, 3 rotatable bonds, 1 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 9-(3,4-dihydro-2H-pyran-4-yl)-2-(5-methylsulfonylbenzimidazol-1-yl)-7H-purin-8-one is sourced from PubChem (CID 141158634), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).