C21H27N3S — CID 141159023
(2S)-N-[[2-(1H-2,1,3-benzothiadiazol-3-yl)phenyl]methyl]-1-cyclopentylpropan-2-amine (PubChem CID 141159023) has the molecular formula C21H27N3S and a molecular weight of 353.54 g/mol. Its IUPAC name is (2S)-N-[[2-(1H-2,1,3-benzothiadiazol-3-yl)phenyl]methyl]-1-cyclopentylpropan-2-amine.
| Compound Name | (2S)-N-[[2-(1H-2,1,3-benzothiadiazol-3-yl)phenyl]methyl]-1-cyclopentylpropan-2-amine |
|---|---|
| PubChem CID | 141159023 |
| Molecular Formula | C21H27N3S |
| Molecular Weight | 353.54 g/mol |
| Exact Mass | 353.19 |
| IUPAC Name | (2S)-N-[[2-(1H-2,1,3-benzothiadiazol-3-yl)phenyl]methyl]-1-cyclopentylpropan-2-amine |
| SMILES | C[C@@H](CC1CCCC1)NCc1ccccc1N1SNc2ccccc21 |
| InChI | InChI=1S/C21H27N3S/c1-16(14-17-8-2-3-9-17)22-15-18-10-4-6-12-20(18)24-21-13-7-5-11-19(21)23-25-24/h4-7,10-13,16-17,22-23H,2-3,8-9,14-15H2,1H3/t16-/m0/s1 |
| InChIKey | NELDXQAZZAXSCS-INIZCTEOSA-N |
| XLogP | 5.87 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.54 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|