C16H23F3N2O4S2 — CID 141159623
5-sulfonyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)-6-(trifluoromethyl)cyclohexa-1,3-diene-1-sulfonamide (PubChem CID 141159623) has the molecular formula C16H23F3N2O4S2 and a molecular weight of 428.50 g/mol. Its IUPAC name is 5-sulfonyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)-6-(trifluoromethyl)cyclohexa-1,3-diene-1-sulfonamide.
| Compound Name | 5-sulfonyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)-6-(trifluoromethyl)cyclohexa-1,3-diene-1-sulfonamide |
|---|---|
| PubChem CID | 141159623 |
| Molecular Formula | C16H23F3N2O4S2 |
| Molecular Weight | 428.50 g/mol |
| Exact Mass | 428.11 |
| IUPAC Name | 5-sulfonyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)-6-(trifluoromethyl)cyclohexa-1,3-diene-1-sulfonamide |
| SMILES | CC1(C)CC(NS(=O)(=O)C2=CC=CC(=S(=O)=O)C2C(F)(F)F)CC(C)(C)N1 |
| InChI | InChI=1S/C16H23F3N2O4S2/c1-14(2)8-10(9-15(3,4)21-14)20-27(24,25)12-7-5-6-11(26(22)23)13(12)16(17,18)19/h5-7,10,13,20-21H,8-9H2,1-4H3 |
| InChIKey | YBYYILPSMNJBFT-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.50 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|