C12H10N4O — CID 141159984
1,4,8-triazatricyclo[8.4.0.03,8]tetradeca-2,4,6,9,11,13-hexaene-13-carboxamide (PubChem CID 141159984) has the molecular formula C12H10N4O and a molecular weight of 226.24 g/mol. Its IUPAC name is 1,4,8-triazatricyclo[8.4.0.03,8]tetradeca-2,4,6,9,11,13-hexaene-13-carboxamide.
| Compound Name | 1,4,8-triazatricyclo[8.4.0.03,8]tetradeca-2,4,6,9,11,13-hexaene-13-carboxamide |
|---|---|
| PubChem CID | 141159984 |
| Molecular Formula | C12H10N4O |
| Molecular Weight | 226.24 g/mol |
| Exact Mass | 226.09 |
| IUPAC Name | 1,4,8-triazatricyclo[8.4.0.03,8]tetradeca-2,4,6,9,11,13-hexaene-13-carboxamide |
| SMILES | NC(=O)C1=CN2C=C3N=CC=CN3C=C2C=C1 |
| InChI | InChI=1S/C12H10N4O/c13-12(17)9-2-3-10-7-15-5-1-4-14-11(15)8-16(10)6-9/h1-8H,(H2,13,17) |
| InChIKey | LPRSVXYNBLRSBQ-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 61.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.24 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |