C14H13FN2O3 — CID 141159987
N-[(4-fluorophenyl)methyl]-6-(hydroxymethyl)-4-oxo-1H-pyridine-3-carboxamide (PubChem CID 141159987) has the molecular formula C14H13FN2O3 and a molecular weight of 276.27 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methyl]-6-(hydroxymethyl)-4-oxo-1H-pyridine-3-carboxamide.
| Compound Name | N-[(4-fluorophenyl)methyl]-6-(hydroxymethyl)-4-oxo-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 141159987 |
| Molecular Formula | C14H13FN2O3 |
| Molecular Weight | 276.27 g/mol |
| Exact Mass | 276.09 |
| IUPAC Name | N-[(4-fluorophenyl)methyl]-6-(hydroxymethyl)-4-oxo-1H-pyridine-3-carboxamide |
| SMILES | O=C(NCc1ccc(F)cc1)c1c[nH]c(CO)cc1=O |
| InChI | InChI=1S/C14H13FN2O3/c15-10-3-1-9(2-4-10)6-17-14(20)12-7-16-11(8-18)5-13(12)19/h1-5,7,18H,6,8H2,(H,16,19)(H,17,20) |
| InChIKey | NFHZIXYTGBASMJ-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.27 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |