C7H8O5 — CID 141160002
1,2,5,6-tetrahydroxycyclohexa-2,4-diene-1-carbaldehyde (PubChem CID 141160002) has the molecular formula C7H8O5 and a molecular weight of 172.14 g/mol. Its IUPAC name is 1,2,5,6-tetrahydroxycyclohexa-2,4-diene-1-carbaldehyde.
| Compound Name | 1,2,5,6-tetrahydroxycyclohexa-2,4-diene-1-carbaldehyde |
|---|---|
| PubChem CID | 141160002 |
| Molecular Formula | C7H8O5 |
| Molecular Weight | 172.14 g/mol |
| Exact Mass | 172.04 |
| IUPAC Name | 1,2,5,6-tetrahydroxycyclohexa-2,4-diene-1-carbaldehyde |
| SMILES | O=CC1(O)C(O)=CC=C(O)C1O |
| InChI | InChI=1S/C7H8O5/c8-3-7(12)5(10)2-1-4(9)6(7)11/h1-3,6,9-12H |
| InChIKey | MULILIRNPAKHPD-UHFFFAOYSA-N |
| XLogP | -0.83 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.14 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|