About [6-chloro-4-(2,4-dichlorophenyl)-1,3-benzodioxol-2-yl]methyl benzenesulfonate
[6-chloro-4-(2,4-dichlorophenyl)-1,3-benzodioxol-2-yl]methyl benzenesulfonate (PubChem CID 141160402) has the molecular formula C20H13Cl3O5S
and a molecular weight of 471.75 g/mol. Its IUPAC name is [6-chloro-4-(2,4-dichlorophenyl)-1,3-benzodioxol-2-yl]methyl benzenesulfonate.
Molecular Properties
| Compound Name | [6-chloro-4-(2,4-dichlorophenyl)-1,3-benzodioxol-2-yl]methyl benzenesulfonate |
| PubChem CID | 141160402 |
| Molecular Formula | C20H13Cl3O5S |
| Molecular Weight | 471.75 g/mol |
| Exact Mass | 469.95 |
| IUPAC Name | [6-chloro-4-(2,4-dichlorophenyl)-1,3-benzodioxol-2-yl]methyl benzenesulfonate |
| SMILES | O=S(=O)(OCC1Oc2cc(Cl)cc(-c3ccc(Cl)cc3Cl)c2O1)c1ccccc1 |
| InChI | InChI=1S/C20H13Cl3O5S/c21-12-6-7-15(17(23)9-12)16-8-13(22)10-18-20(16)28-19(27-18)11-26-29(24,25)14-4-2-1-3-5-14/h1-10,19H,11H2 |
| InChIKey | NOZJYVBWXYJSHH-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 471.75 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [6-chloro-4-(2,4-dichlorophenyl)-1,3-benzodioxol-2-yl]methyl benzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [6-chloro-4-(2,4-dichlorophenyl)-1,3-benzodioxol-2-yl]methyl benzenesulfonate?
The IUPAC name of [6-chloro-4-(2,4-dichlorophenyl)-1,3-benzodioxol-2-yl]methyl benzenesulfonate (CID 141160402) is [6-chloro-4-(2,4-dichlorophenyl)-1,3-benzodioxol-2-yl]methyl benzenesulfonate.
What is the SMILES notation for [6-chloro-4-(2,4-dichlorophenyl)-1,3-benzodioxol-2-yl]methyl benzenesulfonate?
The canonical SMILES for [6-chloro-4-(2,4-dichlorophenyl)-1,3-benzodioxol-2-yl]methyl benzenesulfonate is O=S(=O)(OCC1Oc2cc(Cl)cc(-c3ccc(Cl)cc3Cl)c2O1)c1ccccc1.
What is the InChIKey of [6-chloro-4-(2,4-dichlorophenyl)-1,3-benzodioxol-2-yl]methyl benzenesulfonate?
The InChIKey is NOZJYVBWXYJSHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H13Cl3O5S/c21-12-6-7-15(17(23)9-12)16-8-13(22)10-18-20(16)28-19(27-18)11-26-29(24,25)14-4-2-1-3-5-14/h1-10,19H,11H2.
What are the key properties of [6-chloro-4-(2,4-dichlorophenyl)-1,3-benzodioxol-2-yl]methyl benzenesulfonate?
[6-chloro-4-(2,4-dichlorophenyl)-1,3-benzodioxol-2-yl]methyl benzenesulfonate has a molecular weight of 471.75 g/mol, XLogP of 5.82, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [6-chloro-4-(2,4-dichlorophenyl)-1,3-benzodioxol-2-yl]methyl benzenesulfonate is sourced from PubChem (CID 141160402), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).