About bicyclo[3.3.1]nona-1,3,5,7-tetraene
bicyclo[3.3.1]nona-1,3,5,7-tetraene (PubChem CID 141161601) has the molecular formula C9H8
and a molecular weight of 116.16 g/mol. Its IUPAC name is bicyclo[3.3.1]nona-1,3,5,7-tetraene.
Molecular Properties
| Compound Name | bicyclo[3.3.1]nona-1,3,5,7-tetraene |
| PubChem CID | 141161601 |
| Molecular Formula | C9H8 |
| Molecular Weight | 116.16 g/mol |
| Exact Mass | 116.06 |
| IUPAC Name | bicyclo[3.3.1]nona-1,3,5,7-tetraene |
| SMILES | C1=CC2=CC=CC(=C1)C2 |
| InChI | InChI=1S/C9H8/c1-3-8-5-2-6-9(4-1)7-8/h1-6H,7H2 |
| InChIKey | XFKYCMHLZBCREK-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 116.16 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze bicyclo[3.3.1]nona-1,3,5,7-tetraene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bicyclo[3.3.1]nona-1,3,5,7-tetraene?
The IUPAC name of bicyclo[3.3.1]nona-1,3,5,7-tetraene (CID 141161601) is bicyclo[3.3.1]nona-1,3,5,7-tetraene.
What is the SMILES notation for bicyclo[3.3.1]nona-1,3,5,7-tetraene?
The canonical SMILES for bicyclo[3.3.1]nona-1,3,5,7-tetraene is C1=CC2=CC=CC(=C1)C2.
What is the InChIKey of bicyclo[3.3.1]nona-1,3,5,7-tetraene?
The InChIKey is XFKYCMHLZBCREK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8/c1-3-8-5-2-6-9(4-1)7-8/h1-6H,7H2.
What are the key properties of bicyclo[3.3.1]nona-1,3,5,7-tetraene?
bicyclo[3.3.1]nona-1,3,5,7-tetraene has a molecular weight of 116.16 g/mol, XLogP of 2.37, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for bicyclo[3.3.1]nona-1,3,5,7-tetraene is sourced from PubChem (CID 141161601), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).