About 5-(triazol-1-ylmethyl)-3H-1,3-oxazol-2-one
5-(triazol-1-ylmethyl)-3H-1,3-oxazol-2-one (PubChem CID 141162889) has the molecular formula C6H6N4O2
and a molecular weight of 166.14 g/mol. Its IUPAC name is 5-(triazol-1-ylmethyl)-3H-1,3-oxazol-2-one.
Molecular Properties
| Compound Name | 5-(triazol-1-ylmethyl)-3H-1,3-oxazol-2-one |
| PubChem CID | 141162889 |
| Molecular Formula | C6H6N4O2 |
| Molecular Weight | 166.14 g/mol |
| Exact Mass | 166.05 |
| IUPAC Name | 5-(triazol-1-ylmethyl)-3H-1,3-oxazol-2-one |
| SMILES | O=c1[nH]cc(Cn2ccnn2)o1 |
| InChI | InChI=1S/C6H6N4O2/c11-6-7-3-5(12-6)4-10-2-1-8-9-10/h1-3H,4H2,(H,7,11) |
| InChIKey | BTFXTVKVYHNQIG-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 76.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.14 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-(triazol-1-ylmethyl)-3H-1,3-oxazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(triazol-1-ylmethyl)-3H-1,3-oxazol-2-one?
The IUPAC name of 5-(triazol-1-ylmethyl)-3H-1,3-oxazol-2-one (CID 141162889) is 5-(triazol-1-ylmethyl)-3H-1,3-oxazol-2-one.
What is the SMILES notation for 5-(triazol-1-ylmethyl)-3H-1,3-oxazol-2-one?
The canonical SMILES for 5-(triazol-1-ylmethyl)-3H-1,3-oxazol-2-one is O=c1[nH]cc(Cn2ccnn2)o1.
What is the InChIKey of 5-(triazol-1-ylmethyl)-3H-1,3-oxazol-2-one?
The InChIKey is BTFXTVKVYHNQIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6N4O2/c11-6-7-3-5(12-6)4-10-2-1-8-9-10/h1-3H,4H2,(H,7,11).
What are the key properties of 5-(triazol-1-ylmethyl)-3H-1,3-oxazol-2-one?
5-(triazol-1-ylmethyl)-3H-1,3-oxazol-2-one has a molecular weight of 166.14 g/mol, XLogP of -0.39, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(triazol-1-ylmethyl)-3H-1,3-oxazol-2-one is sourced from PubChem (CID 141162889), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).