C16H28O3 — CID 141162952
cyclohexyl-[1-(1,3-dioxolan-2-yl)cyclohexyl]methanol (PubChem CID 141162952) has the molecular formula C16H28O3 and a molecular weight of 268.40 g/mol. Its IUPAC name is cyclohexyl-[1-(1,3-dioxolan-2-yl)cyclohexyl]methanol.
| Compound Name | cyclohexyl-[1-(1,3-dioxolan-2-yl)cyclohexyl]methanol |
|---|---|
| PubChem CID | 141162952 |
| Molecular Formula | C16H28O3 |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.20 |
| IUPAC Name | cyclohexyl-[1-(1,3-dioxolan-2-yl)cyclohexyl]methanol |
| SMILES | OC(C1CCCCC1)C1(C2OCCO2)CCCCC1 |
| InChI | InChI=1S/C16H28O3/c17-14(13-7-3-1-4-8-13)16(9-5-2-6-10-16)15-18-11-12-19-15/h13-15,17H,1-12H2 |
| InChIKey | YPEJLQQYPDZFNY-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |