About 1-cyclohexa-2,4-dien-1-ylidene-3-ethylurea
1-cyclohexa-2,4-dien-1-ylidene-3-ethylurea (PubChem CID 141163063) has the molecular formula C9H12N2O
and a molecular weight of 164.21 g/mol. Its IUPAC name is 1-cyclohexa-2,4-dien-1-ylidene-3-ethylurea.
Molecular Properties
| Compound Name | 1-cyclohexa-2,4-dien-1-ylidene-3-ethylurea |
| PubChem CID | 141163063 |
| Molecular Formula | C9H12N2O |
| Molecular Weight | 164.21 g/mol |
| Exact Mass | 164.09 |
| IUPAC Name | 1-cyclohexa-2,4-dien-1-ylidene-3-ethylurea |
| SMILES | CCNC(=O)N=C1C=CC=CC1 |
| InChI | InChI=1S/C9H12N2O/c1-2-10-9(12)11-8-6-4-3-5-7-8/h3-6H,2,7H2,1H3,(H,10,12) |
| InChIKey | KLFABANDQFHIDV-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.21 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 1-cyclohexa-2,4-dien-1-ylidene-3-ethylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclohexa-2,4-dien-1-ylidene-3-ethylurea?
The IUPAC name of 1-cyclohexa-2,4-dien-1-ylidene-3-ethylurea (CID 141163063) is 1-cyclohexa-2,4-dien-1-ylidene-3-ethylurea.
What is the SMILES notation for 1-cyclohexa-2,4-dien-1-ylidene-3-ethylurea?
The canonical SMILES for 1-cyclohexa-2,4-dien-1-ylidene-3-ethylurea is CCNC(=O)N=C1C=CC=CC1.
What is the InChIKey of 1-cyclohexa-2,4-dien-1-ylidene-3-ethylurea?
The InChIKey is KLFABANDQFHIDV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2O/c1-2-10-9(12)11-8-6-4-3-5-7-8/h3-6H,2,7H2,1H3,(H,10,12).
What are the key properties of 1-cyclohexa-2,4-dien-1-ylidene-3-ethylurea?
1-cyclohexa-2,4-dien-1-ylidene-3-ethylurea has a molecular weight of 164.21 g/mol, XLogP of 1.67, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclohexa-2,4-dien-1-ylidene-3-ethylurea is sourced from PubChem (CID 141163063), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).