About 2-(dimethylamino)ethyl 4-(5-cyclopropylpyrazol-1-yl)piperidine-1-carboxylate
2-(dimethylamino)ethyl 4-(5-cyclopropylpyrazol-1-yl)piperidine-1-carboxylate (PubChem CID 141163306) has the molecular formula C16H26N4O2
and a molecular weight of 306.41 g/mol. Its IUPAC name is 2-(dimethylamino)ethyl 4-(5-cyclopropylpyrazol-1-yl)piperidine-1-carboxylate.
Molecular Properties
| Compound Name | 2-(dimethylamino)ethyl 4-(5-cyclopropylpyrazol-1-yl)piperidine-1-carboxylate |
| PubChem CID | 141163306 |
| Molecular Formula | C16H26N4O2 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.21 |
| IUPAC Name | 2-(dimethylamino)ethyl 4-(5-cyclopropylpyrazol-1-yl)piperidine-1-carboxylate |
| SMILES | CN(C)CCOC(=O)N1CCC(n2nccc2C2CC2)CC1 |
| InChI | InChI=1S/C16H26N4O2/c1-18(2)11-12-22-16(21)19-9-6-14(7-10-19)20-15(5-8-17-20)13-3-4-13/h5,8,13-14H,3-4,6-7,9-12H2,1-2H3 |
| InChIKey | KXSWVDKVFDKJIV-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 50.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(dimethylamino)ethyl 4-(5-cyclopropylpyrazol-1-yl)piperidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(dimethylamino)ethyl 4-(5-cyclopropylpyrazol-1-yl)piperidine-1-carboxylate?
The IUPAC name of 2-(dimethylamino)ethyl 4-(5-cyclopropylpyrazol-1-yl)piperidine-1-carboxylate (CID 141163306) is 2-(dimethylamino)ethyl 4-(5-cyclopropylpyrazol-1-yl)piperidine-1-carboxylate.
What is the SMILES notation for 2-(dimethylamino)ethyl 4-(5-cyclopropylpyrazol-1-yl)piperidine-1-carboxylate?
The canonical SMILES for 2-(dimethylamino)ethyl 4-(5-cyclopropylpyrazol-1-yl)piperidine-1-carboxylate is CN(C)CCOC(=O)N1CCC(n2nccc2C2CC2)CC1.
What is the InChIKey of 2-(dimethylamino)ethyl 4-(5-cyclopropylpyrazol-1-yl)piperidine-1-carboxylate?
The InChIKey is KXSWVDKVFDKJIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H26N4O2/c1-18(2)11-12-22-16(21)19-9-6-14(7-10-19)20-15(5-8-17-20)13-3-4-13/h5,8,13-14H,3-4,6-7,9-12H2,1-2H3.
What are the key properties of 2-(dimethylamino)ethyl 4-(5-cyclopropylpyrazol-1-yl)piperidine-1-carboxylate?
2-(dimethylamino)ethyl 4-(5-cyclopropylpyrazol-1-yl)piperidine-1-carboxylate has a molecular weight of 306.41 g/mol, XLogP of 2.10, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(dimethylamino)ethyl 4-(5-cyclopropylpyrazol-1-yl)piperidine-1-carboxylate is sourced from PubChem (CID 141163306), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).