C9H16F4O7P2 — CID 14116401
[(E)-1-dimethoxyphosphoryl-1,3,3,3-tetrafluoroprop-1-en-2-yl] diethyl phosphate (PubChem CID 14116401) has the molecular formula C9H16F4O7P2 and a molecular weight of 374.16 g/mol. Its IUPAC name is [(E)-1-dimethoxyphosphoryl-1,3,3,3-tetrafluoroprop-1-en-2-yl] diethyl phosphate.
| Compound Name | [(E)-1-dimethoxyphosphoryl-1,3,3,3-tetrafluoroprop-1-en-2-yl] diethyl phosphate |
|---|---|
| PubChem CID | 14116401 |
| Molecular Formula | C9H16F4O7P2 |
| Molecular Weight | 374.16 g/mol |
| Exact Mass | 374.03 |
| IUPAC Name | [(E)-1-dimethoxyphosphoryl-1,3,3,3-tetrafluoroprop-1-en-2-yl] diethyl phosphate |
| SMILES | CCOP(=O)(OCC)O/C(=C(\F)P(=O)(OC)OC)C(F)(F)F |
| InChI | InChI=1S/C9H16F4O7P2/c1-5-18-22(15,19-6-2)20-7(9(11,12)13)8(10)21(14,16-3)17-4/h5-6H2,1-4H3/b8-7+ |
| InChIKey | JCYPNNGTJZODQE-BQYQJAHWSA-N |
| XLogP | 4.37 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.16 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|