C18H15Cl2FN2O — CID 141164391
2-[2-(2-chloro-6-fluorophenyl)-1-(2-chlorophenyl)imidazol-4-yl]propan-2-ol (PubChem CID 141164391) has the molecular formula C18H15Cl2FN2O and a molecular weight of 365.24 g/mol. Its IUPAC name is 2-[2-(2-chloro-6-fluorophenyl)-1-(2-chlorophenyl)imidazol-4-yl]propan-2-ol.
| Compound Name | 2-[2-(2-chloro-6-fluorophenyl)-1-(2-chlorophenyl)imidazol-4-yl]propan-2-ol |
|---|---|
| PubChem CID | 141164391 |
| Molecular Formula | C18H15Cl2FN2O |
| Molecular Weight | 365.24 g/mol |
| Exact Mass | 364.05 |
| IUPAC Name | 2-[2-(2-chloro-6-fluorophenyl)-1-(2-chlorophenyl)imidazol-4-yl]propan-2-ol |
| SMILES | CC(C)(O)c1cn(-c2ccccc2Cl)c(-c2c(F)cccc2Cl)n1 |
| InChI | InChI=1S/C18H15Cl2FN2O/c1-18(2,24)15-10-23(14-9-4-3-6-11(14)19)17(22-15)16-12(20)7-5-8-13(16)21/h3-10,24H,1-2H3 |
| InChIKey | BJBMUZWGBWBGAP-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.24 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |