C19H15F3N2O3S — CID 141164535
1-[5-[5-(trifluoromethyl)indol-1-yl]sulfonyl-2,3-dihydroindol-1-yl]ethanone (PubChem CID 141164535) has the molecular formula C19H15F3N2O3S and a molecular weight of 408.40 g/mol. Its IUPAC name is 1-[5-[5-(trifluoromethyl)indol-1-yl]sulfonyl-2,3-dihydroindol-1-yl]ethanone.
| Compound Name | 1-[5-[5-(trifluoromethyl)indol-1-yl]sulfonyl-2,3-dihydroindol-1-yl]ethanone |
|---|---|
| PubChem CID | 141164535 |
| Molecular Formula | C19H15F3N2O3S |
| Molecular Weight | 408.40 g/mol |
| Exact Mass | 408.08 |
| IUPAC Name | 1-[5-[5-(trifluoromethyl)indol-1-yl]sulfonyl-2,3-dihydroindol-1-yl]ethanone |
| SMILES | CC(=O)N1CCc2cc(S(=O)(=O)n3ccc4cc(C(F)(F)F)ccc43)ccc21 |
| InChI | InChI=1S/C19H15F3N2O3S/c1-12(25)23-8-6-14-11-16(3-5-17(14)23)28(26,27)24-9-7-13-10-15(19(20,21)22)2-4-18(13)24/h2-5,7,9-11H,6,8H2,1H3 |
| InChIKey | ADJHSKLKKQUGPA-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 59.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.40 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |