C12H20O3 — CID 14116462
4-butyl-2-ethoxy-3,4-dihydro-2H-pyran-5-carbaldehyde (PubChem CID 14116462) has the molecular formula C12H20O3 and a molecular weight of 212.29 g/mol. Its IUPAC name is 4-butyl-2-ethoxy-3,4-dihydro-2H-pyran-5-carbaldehyde.
| Compound Name | 4-butyl-2-ethoxy-3,4-dihydro-2H-pyran-5-carbaldehyde |
|---|---|
| PubChem CID | 14116462 |
| Molecular Formula | C12H20O3 |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.14 |
| IUPAC Name | 4-butyl-2-ethoxy-3,4-dihydro-2H-pyran-5-carbaldehyde |
| SMILES | CCCCC1CC(OCC)OC=C1C=O |
| InChI | InChI=1S/C12H20O3/c1-3-5-6-10-7-12(14-4-2)15-9-11(10)8-13/h8-10,12H,3-7H2,1-2H3 |
| InChIKey | RLSPHXYSKWTLBP-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|