About 4-[(2,4-diaminophenoxy)-phenylmethoxy]benzene-1,3-diamine
4-[(2,4-diaminophenoxy)-phenylmethoxy]benzene-1,3-diamine (PubChem CID 141165191) has the molecular formula C19H20N4O2
and a molecular weight of 336.40 g/mol. Its IUPAC name is 4-[(2,4-diaminophenoxy)-phenylmethoxy]benzene-1,3-diamine.
Molecular Properties
| Compound Name | 4-[(2,4-diaminophenoxy)-phenylmethoxy]benzene-1,3-diamine |
| PubChem CID | 141165191 |
| Molecular Formula | C19H20N4O2 |
| Molecular Weight | 336.40 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | 4-[(2,4-diaminophenoxy)-phenylmethoxy]benzene-1,3-diamine |
| SMILES | Nc1ccc(OC(Oc2ccc(N)cc2N)c2ccccc2)c(N)c1 |
| InChI | InChI=1S/C19H20N4O2/c20-13-6-8-17(15(22)10-13)24-19(12-4-2-1-3-5-12)25-18-9-7-14(21)11-16(18)23/h1-11,19H,20-23H2 |
| InChIKey | HQYRMTJJWKKLPN-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 122.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.40 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 4-[(2,4-diaminophenoxy)-phenylmethoxy]benzene-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(2,4-diaminophenoxy)-phenylmethoxy]benzene-1,3-diamine?
The IUPAC name of 4-[(2,4-diaminophenoxy)-phenylmethoxy]benzene-1,3-diamine (CID 141165191) is 4-[(2,4-diaminophenoxy)-phenylmethoxy]benzene-1,3-diamine.
What is the SMILES notation for 4-[(2,4-diaminophenoxy)-phenylmethoxy]benzene-1,3-diamine?
The canonical SMILES for 4-[(2,4-diaminophenoxy)-phenylmethoxy]benzene-1,3-diamine is Nc1ccc(OC(Oc2ccc(N)cc2N)c2ccccc2)c(N)c1.
What is the InChIKey of 4-[(2,4-diaminophenoxy)-phenylmethoxy]benzene-1,3-diamine?
The InChIKey is HQYRMTJJWKKLPN-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20N4O2/c20-13-6-8-17(15(22)10-13)24-19(12-4-2-1-3-5-12)25-18-9-7-14(21)11-16(18)23/h1-11,19H,20-23H2.
What are the key properties of 4-[(2,4-diaminophenoxy)-phenylmethoxy]benzene-1,3-diamine?
4-[(2,4-diaminophenoxy)-phenylmethoxy]benzene-1,3-diamine has a molecular weight of 336.40 g/mol, XLogP of 3.17, 5 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2,4-diaminophenoxy)-phenylmethoxy]benzene-1,3-diamine is sourced from PubChem (CID 141165191), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).