C24H33NO6 — CID 141165374
(6S)-10-[3-[4-(4-hydroxy-4-methylcyclohexyl)phenoxy]propyl]-6-methyl-1,4-dioxa-10-azaspiro[4.5]decane-2,3-dione (PubChem CID 141165374) has the molecular formula C24H33NO6 and a molecular weight of 431.53 g/mol. Its IUPAC name is (6S)-10-[3-[4-(4-hydroxy-4-methylcyclohexyl)phenoxy]propyl]-6-methyl-1,4-dioxa-10-azaspiro[4.5]decane-2,3-dione.
| Compound Name | (6S)-10-[3-[4-(4-hydroxy-4-methylcyclohexyl)phenoxy]propyl]-6-methyl-1,4-dioxa-10-azaspiro[4.5]decane-2,3-dione |
|---|---|
| PubChem CID | 141165374 |
| Molecular Formula | C24H33NO6 |
| Molecular Weight | 431.53 g/mol |
| Exact Mass | 431.23 |
| IUPAC Name | (6S)-10-[3-[4-(4-hydroxy-4-methylcyclohexyl)phenoxy]propyl]-6-methyl-1,4-dioxa-10-azaspiro[4.5]decane-2,3-dione |
| SMILES | C[C@H]1CCCN(CCCOc2ccc(C3CCC(C)(O)CC3)cc2)C12OC(=O)C(=O)O2 |
| InChI | InChI=1S/C24H33NO6/c1-17-5-3-14-25(24(17)30-21(26)22(27)31-24)15-4-16-29-20-8-6-18(7-9-20)19-10-12-23(2,28)13-11-19/h6-9,17,19,28H,3-5,10-16H2,1-2H3/t17-,19?,23?/m0/s1 |
| InChIKey | OLWTXFYBAVCWAV-OYMFQORVSA-N |
| XLogP | 3.35 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.53 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|