About 5-[(E)-but-2-enyl]-2,2-dimethyl-4-prop-2-enyl-1,3-dioxane
5-[(E)-but-2-enyl]-2,2-dimethyl-4-prop-2-enyl-1,3-dioxane (PubChem CID 141165843) has the molecular formula C13H22O2
and a molecular weight of 210.32 g/mol. Its IUPAC name is 5-[(E)-but-2-enyl]-2,2-dimethyl-4-prop-2-enyl-1,3-dioxane.
Molecular Properties
| Compound Name | 5-[(E)-but-2-enyl]-2,2-dimethyl-4-prop-2-enyl-1,3-dioxane |
| PubChem CID | 141165843 |
| Molecular Formula | C13H22O2 |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.16 |
| IUPAC Name | 5-[(E)-but-2-enyl]-2,2-dimethyl-4-prop-2-enyl-1,3-dioxane |
| SMILES | C=CCC1OC(C)(C)OCC1C/C=C/C |
| InChI | InChI=1S/C13H22O2/c1-5-7-9-11-10-14-13(3,4)15-12(11)8-6-2/h5-7,11-12H,2,8-10H2,1,3-4H3/b7-5+ |
| InChIKey | OLUDNJPASGVOCE-FNORWQNLSA-N |
| XLogP | 3.30 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-[(E)-but-2-enyl]-2,2-dimethyl-4-prop-2-enyl-1,3-dioxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(E)-but-2-enyl]-2,2-dimethyl-4-prop-2-enyl-1,3-dioxane?
The IUPAC name of 5-[(E)-but-2-enyl]-2,2-dimethyl-4-prop-2-enyl-1,3-dioxane (CID 141165843) is 5-[(E)-but-2-enyl]-2,2-dimethyl-4-prop-2-enyl-1,3-dioxane.
What is the SMILES notation for 5-[(E)-but-2-enyl]-2,2-dimethyl-4-prop-2-enyl-1,3-dioxane?
The canonical SMILES for 5-[(E)-but-2-enyl]-2,2-dimethyl-4-prop-2-enyl-1,3-dioxane is C=CCC1OC(C)(C)OCC1C/C=C/C.
What is the InChIKey of 5-[(E)-but-2-enyl]-2,2-dimethyl-4-prop-2-enyl-1,3-dioxane?
The InChIKey is OLUDNJPASGVOCE-FNORWQNLSA-N. The full InChI is InChI=1S/C13H22O2/c1-5-7-9-11-10-14-13(3,4)15-12(11)8-6-2/h5-7,11-12H,2,8-10H2,1,3-4H3/b7-5+.
What are the key properties of 5-[(E)-but-2-enyl]-2,2-dimethyl-4-prop-2-enyl-1,3-dioxane?
5-[(E)-but-2-enyl]-2,2-dimethyl-4-prop-2-enyl-1,3-dioxane has a molecular weight of 210.32 g/mol, XLogP of 3.30, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(E)-but-2-enyl]-2,2-dimethyl-4-prop-2-enyl-1,3-dioxane is sourced from PubChem (CID 141165843), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).