C16H17ClN6O3 — CID 141166084
1-[4-azido-3-chloro-5-(5-ethyl-1,3-oxazol-2-yl)-2-pyridinyl]piperidine-4-carboxylic acid (PubChem CID 141166084) has the molecular formula C16H17ClN6O3 and a molecular weight of 376.80 g/mol. Its IUPAC name is 1-[4-azido-3-chloro-5-(5-ethyl-1,3-oxazol-2-yl)-2-pyridinyl]piperidine-4-carboxylic acid.
| Compound Name | 1-[4-azido-3-chloro-5-(5-ethyl-1,3-oxazol-2-yl)-2-pyridinyl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 141166084 |
| Molecular Formula | C16H17ClN6O3 |
| Molecular Weight | 376.80 g/mol |
| Exact Mass | 376.11 |
| IUPAC Name | 1-[4-azido-3-chloro-5-(5-ethyl-1,3-oxazol-2-yl)-2-pyridinyl]piperidine-4-carboxylic acid |
| SMILES | CCc1cnc(-c2cnc(N3CCC(C(=O)O)CC3)c(Cl)c2N=[N+]=[N-])o1 |
| InChI | InChI=1S/C16H17ClN6O3/c1-2-10-7-20-15(26-10)11-8-19-14(12(17)13(11)21-22-18)23-5-3-9(4-6-23)16(24)25/h7-9H,2-6H2,1H3,(H,24,25) |
| InChIKey | AKSOUEPGPZMTOR-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 128.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.80 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|