About N-[3-[(4-aminothieno[3,2-c]pyridin-3-yl)methoxy]-4-methylphenyl]-3-chlorobenzamide
N-[3-[(4-aminothieno[3,2-c]pyridin-3-yl)methoxy]-4-methylphenyl]-3-chlorobenzamide (PubChem CID 141166238) has the molecular formula C22H18ClN3O2S
and a molecular weight of 423.93 g/mol. Its IUPAC name is N-[3-[(4-aminothieno[3,2-c]pyridin-3-yl)methoxy]-4-methylphenyl]-3-chlorobenzamide.
Molecular Properties
| Compound Name | N-[3-[(4-aminothieno[3,2-c]pyridin-3-yl)methoxy]-4-methylphenyl]-3-chlorobenzamide |
| PubChem CID | 141166238 |
| Molecular Formula | C22H18ClN3O2S |
| Molecular Weight | 423.93 g/mol |
| Exact Mass | 423.08 |
| IUPAC Name | N-[3-[(4-aminothieno[3,2-c]pyridin-3-yl)methoxy]-4-methylphenyl]-3-chlorobenzamide |
| SMILES | Cc1ccc(NC(=O)c2cccc(Cl)c2)cc1OCc1csc2ccnc(N)c12 |
| InChI | InChI=1S/C22H18ClN3O2S/c1-13-5-6-17(26-22(27)14-3-2-4-16(23)9-14)10-18(13)28-11-15-12-29-19-7-8-25-21(24)20(15)19/h2-10,12H,11H2,1H3,(H2,24,25)(H,26,27) |
| InChIKey | OWUKOMHWHPRXHL-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 423.93 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[3-[(4-aminothieno[3,2-c]pyridin-3-yl)methoxy]-4-methylphenyl]-3-chlorobenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-[(4-aminothieno[3,2-c]pyridin-3-yl)methoxy]-4-methylphenyl]-3-chlorobenzamide?
The IUPAC name of N-[3-[(4-aminothieno[3,2-c]pyridin-3-yl)methoxy]-4-methylphenyl]-3-chlorobenzamide (CID 141166238) is N-[3-[(4-aminothieno[3,2-c]pyridin-3-yl)methoxy]-4-methylphenyl]-3-chlorobenzamide.
What is the SMILES notation for N-[3-[(4-aminothieno[3,2-c]pyridin-3-yl)methoxy]-4-methylphenyl]-3-chlorobenzamide?
The canonical SMILES for N-[3-[(4-aminothieno[3,2-c]pyridin-3-yl)methoxy]-4-methylphenyl]-3-chlorobenzamide is Cc1ccc(NC(=O)c2cccc(Cl)c2)cc1OCc1csc2ccnc(N)c12.
What is the InChIKey of N-[3-[(4-aminothieno[3,2-c]pyridin-3-yl)methoxy]-4-methylphenyl]-3-chlorobenzamide?
The InChIKey is OWUKOMHWHPRXHL-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H18ClN3O2S/c1-13-5-6-17(26-22(27)14-3-2-4-16(23)9-14)10-18(13)28-11-15-12-29-19-7-8-25-21(24)20(15)19/h2-10,12H,11H2,1H3,(H2,24,25)(H,26,27).
What are the key properties of N-[3-[(4-aminothieno[3,2-c]pyridin-3-yl)methoxy]-4-methylphenyl]-3-chlorobenzamide?
N-[3-[(4-aminothieno[3,2-c]pyridin-3-yl)methoxy]-4-methylphenyl]-3-chlorobenzamide has a molecular weight of 423.93 g/mol, XLogP of 5.67, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-[(4-aminothieno[3,2-c]pyridin-3-yl)methoxy]-4-methylphenyl]-3-chlorobenzamide is sourced from PubChem (CID 141166238), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).