C9H18O6 — CID 141166377
2,2,3,3,4-pentahydroxynonanal (PubChem CID 141166377) has the molecular formula C9H18O6 and a molecular weight of 222.24 g/mol. Its IUPAC name is 2,2,3,3,4-pentahydroxynonanal.
| Compound Name | 2,2,3,3,4-pentahydroxynonanal |
|---|---|
| PubChem CID | 141166377 |
| Molecular Formula | C9H18O6 |
| Molecular Weight | 222.24 g/mol |
| Exact Mass | 222.11 |
| IUPAC Name | 2,2,3,3,4-pentahydroxynonanal |
| SMILES | CCCCCC(O)C(O)(O)C(O)(O)C=O |
| InChI | InChI=1S/C9H18O6/c1-2-3-4-5-7(11)9(14,15)8(12,13)6-10/h6-7,11-15H,2-5H2,1H3 |
| InChIKey | QLCGQLNTQVCBCD-UHFFFAOYSA-N |
| XLogP | -1.51 |
| TPSA | 118.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.24 |
| LogP ≤ 5 | -1.51 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|