C10H20O6 — CID 141166384
2,2,3,3,4-pentahydroxydecanal (PubChem CID 141166384) has the molecular formula C10H20O6 and a molecular weight of 236.26 g/mol. Its IUPAC name is 2,2,3,3,4-pentahydroxydecanal.
| Compound Name | 2,2,3,3,4-pentahydroxydecanal |
|---|---|
| PubChem CID | 141166384 |
| Molecular Formula | C10H20O6 |
| Molecular Weight | 236.26 g/mol |
| Exact Mass | 236.13 |
| IUPAC Name | 2,2,3,3,4-pentahydroxydecanal |
| SMILES | CCCCCCC(O)C(O)(O)C(O)(O)C=O |
| InChI | InChI=1S/C10H20O6/c1-2-3-4-5-6-8(12)10(15,16)9(13,14)7-11/h7-8,12-16H,2-6H2,1H3 |
| InChIKey | JBPSGUHJIQJTRJ-UHFFFAOYSA-N |
| XLogP | -1.12 |
| TPSA | 118.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.26 |
| LogP ≤ 5 | -1.12 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|