About 2H-1,3-benzoxazine-2-carbonitrile
2H-1,3-benzoxazine-2-carbonitrile (PubChem CID 141167030) has the molecular formula C9H6N2O
and a molecular weight of 158.16 g/mol. Its IUPAC name is 2H-1,3-benzoxazine-2-carbonitrile.
Molecular Properties
| Compound Name | 2H-1,3-benzoxazine-2-carbonitrile |
| PubChem CID | 141167030 |
| Molecular Formula | C9H6N2O |
| Molecular Weight | 158.16 g/mol |
| Exact Mass | 158.05 |
| IUPAC Name | 2H-1,3-benzoxazine-2-carbonitrile |
| SMILES | N#CC1N=Cc2ccccc2O1 |
| InChI | InChI=1S/C9H6N2O/c10-5-9-11-6-7-3-1-2-4-8(7)12-9/h1-4,6,9H |
| InChIKey | JPVNZDAXJGWSKV-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 45.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.16 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2H-1,3-benzoxazine-2-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2H-1,3-benzoxazine-2-carbonitrile?
The IUPAC name of 2H-1,3-benzoxazine-2-carbonitrile (CID 141167030) is 2H-1,3-benzoxazine-2-carbonitrile.
What is the SMILES notation for 2H-1,3-benzoxazine-2-carbonitrile?
The canonical SMILES for 2H-1,3-benzoxazine-2-carbonitrile is N#CC1N=Cc2ccccc2O1.
What is the InChIKey of 2H-1,3-benzoxazine-2-carbonitrile?
The InChIKey is JPVNZDAXJGWSKV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6N2O/c10-5-9-11-6-7-3-1-2-4-8(7)12-9/h1-4,6,9H.
What are the key properties of 2H-1,3-benzoxazine-2-carbonitrile?
2H-1,3-benzoxazine-2-carbonitrile has a molecular weight of 158.16 g/mol, XLogP of 1.35, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2H-1,3-benzoxazine-2-carbonitrile is sourced from PubChem (CID 141167030), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).