C13H20O4 — CID 141167644
3,4,4,5,5-pentamethyl-3-(3-oxobut-1-en-2-yloxy)oxolan-2-one (PubChem CID 141167644) has the molecular formula C13H20O4 and a molecular weight of 240.30 g/mol. Its IUPAC name is 3,4,4,5,5-pentamethyl-3-(3-oxobut-1-en-2-yloxy)oxolan-2-one.
| Compound Name | 3,4,4,5,5-pentamethyl-3-(3-oxobut-1-en-2-yloxy)oxolan-2-one |
|---|---|
| PubChem CID | 141167644 |
| Molecular Formula | C13H20O4 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | 3,4,4,5,5-pentamethyl-3-(3-oxobut-1-en-2-yloxy)oxolan-2-one |
| SMILES | C=C(OC1(C)C(=O)OC(C)(C)C1(C)C)C(C)=O |
| InChI | InChI=1S/C13H20O4/c1-8(14)9(2)16-13(7)10(15)17-12(5,6)11(13,3)4/h2H2,1,3-7H3 |
| InChIKey | HNRNFDQNTDMKSD-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|