About 2-phenyl-1,3-benzothiazole-5,6-diol
2-phenyl-1,3-benzothiazole-5,6-diol (PubChem CID 141168347) has the molecular formula C13H9NO2S
and a molecular weight of 243.29 g/mol. Its IUPAC name is 2-phenyl-1,3-benzothiazole-5,6-diol.
Molecular Properties
| Compound Name | 2-phenyl-1,3-benzothiazole-5,6-diol |
| PubChem CID | 141168347 |
| Molecular Formula | C13H9NO2S |
| Molecular Weight | 243.29 g/mol |
| Exact Mass | 243.04 |
| IUPAC Name | 2-phenyl-1,3-benzothiazole-5,6-diol |
| SMILES | Oc1cc2nc(-c3ccccc3)sc2cc1O |
| InChI | InChI=1S/C13H9NO2S/c15-10-6-9-12(7-11(10)16)17-13(14-9)8-4-2-1-3-5-8/h1-7,15-16H |
| InChIKey | BSNRMIXPLLKBNM-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.29 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze 2-phenyl-1,3-benzothiazole-5,6-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenyl-1,3-benzothiazole-5,6-diol?
The IUPAC name of 2-phenyl-1,3-benzothiazole-5,6-diol (CID 141168347) is 2-phenyl-1,3-benzothiazole-5,6-diol.
What is the SMILES notation for 2-phenyl-1,3-benzothiazole-5,6-diol?
The canonical SMILES for 2-phenyl-1,3-benzothiazole-5,6-diol is Oc1cc2nc(-c3ccccc3)sc2cc1O.
What is the InChIKey of 2-phenyl-1,3-benzothiazole-5,6-diol?
The InChIKey is BSNRMIXPLLKBNM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9NO2S/c15-10-6-9-12(7-11(10)16)17-13(14-9)8-4-2-1-3-5-8/h1-7,15-16H.
What are the key properties of 2-phenyl-1,3-benzothiazole-5,6-diol?
2-phenyl-1,3-benzothiazole-5,6-diol has a molecular weight of 243.29 g/mol, XLogP of 3.37, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenyl-1,3-benzothiazole-5,6-diol is sourced from PubChem (CID 141168347), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).