About 2-[4-[(2-methylpropan-2-yl)oxycarbonylamino]piperazin-1-yl]ethyl 4-amino-4-oxobutanoate
2-[4-[(2-methylpropan-2-yl)oxycarbonylamino]piperazin-1-yl]ethyl 4-amino-4-oxobutanoate (PubChem CID 141168513) has the molecular formula C15H28N4O5
and a molecular weight of 344.41 g/mol. Its IUPAC name is 2-[4-[(2-methylpropan-2-yl)oxycarbonylamino]piperazin-1-yl]ethyl 4-amino-4-oxobutanoate.
Molecular Properties
| Compound Name | 2-[4-[(2-methylpropan-2-yl)oxycarbonylamino]piperazin-1-yl]ethyl 4-amino-4-oxobutanoate |
| PubChem CID | 141168513 |
| Molecular Formula | C15H28N4O5 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.21 |
| IUPAC Name | 2-[4-[(2-methylpropan-2-yl)oxycarbonylamino]piperazin-1-yl]ethyl 4-amino-4-oxobutanoate |
| SMILES | CC(C)(C)OC(=O)NN1CCN(CCOC(=O)CCC(N)=O)CC1 |
| InChI | InChI=1S/C15H28N4O5/c1-15(2,3)24-14(22)17-19-8-6-18(7-9-19)10-11-23-13(21)5-4-12(16)20/h4-11H2,1-3H3,(H2,16,20)(H,17,22) |
| InChIKey | CBBLLAVTCJAJQI-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 114.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-[4-[(2-methylpropan-2-yl)oxycarbonylamino]piperazin-1-yl]ethyl 4-amino-4-oxobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-[(2-methylpropan-2-yl)oxycarbonylamino]piperazin-1-yl]ethyl 4-amino-4-oxobutanoate?
The IUPAC name of 2-[4-[(2-methylpropan-2-yl)oxycarbonylamino]piperazin-1-yl]ethyl 4-amino-4-oxobutanoate (CID 141168513) is 2-[4-[(2-methylpropan-2-yl)oxycarbonylamino]piperazin-1-yl]ethyl 4-amino-4-oxobutanoate.
What is the SMILES notation for 2-[4-[(2-methylpropan-2-yl)oxycarbonylamino]piperazin-1-yl]ethyl 4-amino-4-oxobutanoate?
The canonical SMILES for 2-[4-[(2-methylpropan-2-yl)oxycarbonylamino]piperazin-1-yl]ethyl 4-amino-4-oxobutanoate is CC(C)(C)OC(=O)NN1CCN(CCOC(=O)CCC(N)=O)CC1.
What is the InChIKey of 2-[4-[(2-methylpropan-2-yl)oxycarbonylamino]piperazin-1-yl]ethyl 4-amino-4-oxobutanoate?
The InChIKey is CBBLLAVTCJAJQI-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H28N4O5/c1-15(2,3)24-14(22)17-19-8-6-18(7-9-19)10-11-23-13(21)5-4-12(16)20/h4-11H2,1-3H3,(H2,16,20)(H,17,22).
What are the key properties of 2-[4-[(2-methylpropan-2-yl)oxycarbonylamino]piperazin-1-yl]ethyl 4-amino-4-oxobutanoate?
2-[4-[(2-methylpropan-2-yl)oxycarbonylamino]piperazin-1-yl]ethyl 4-amino-4-oxobutanoate has a molecular weight of 344.41 g/mol, XLogP of -0.15, 7 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[(2-methylpropan-2-yl)oxycarbonylamino]piperazin-1-yl]ethyl 4-amino-4-oxobutanoate is sourced from PubChem (CID 141168513), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).