About 2-[(2,4-dichloropyrrolo[2,3-d]pyrimidin-7-yl)methoxy]ethyl acetate
2-[(2,4-dichloropyrrolo[2,3-d]pyrimidin-7-yl)methoxy]ethyl acetate (PubChem CID 14116872) has the molecular formula C11H11Cl2N3O3
and a molecular weight of 304.13 g/mol. Its IUPAC name is 2-[(2,4-dichloropyrrolo[2,3-d]pyrimidin-7-yl)methoxy]ethyl acetate.
Molecular Properties
| Compound Name | 2-[(2,4-dichloropyrrolo[2,3-d]pyrimidin-7-yl)methoxy]ethyl acetate |
| PubChem CID | 14116872 |
| Molecular Formula | C11H11Cl2N3O3 |
| Molecular Weight | 304.13 g/mol |
| Exact Mass | 303.02 |
| IUPAC Name | 2-[(2,4-dichloropyrrolo[2,3-d]pyrimidin-7-yl)methoxy]ethyl acetate |
| SMILES | CC(=O)OCCOCn1ccc2c(Cl)nc(Cl)nc21 |
| InChI | InChI=1S/C11H11Cl2N3O3/c1-7(17)19-5-4-18-6-16-3-2-8-9(12)14-11(13)15-10(8)16/h2-3H,4-6H2,1H3 |
| InChIKey | ATERVKPNFRFKQS-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 66.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.13 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[(2,4-dichloropyrrolo[2,3-d]pyrimidin-7-yl)methoxy]ethyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2,4-dichloropyrrolo[2,3-d]pyrimidin-7-yl)methoxy]ethyl acetate?
The IUPAC name of 2-[(2,4-dichloropyrrolo[2,3-d]pyrimidin-7-yl)methoxy]ethyl acetate (CID 14116872) is 2-[(2,4-dichloropyrrolo[2,3-d]pyrimidin-7-yl)methoxy]ethyl acetate.
What is the SMILES notation for 2-[(2,4-dichloropyrrolo[2,3-d]pyrimidin-7-yl)methoxy]ethyl acetate?
The canonical SMILES for 2-[(2,4-dichloropyrrolo[2,3-d]pyrimidin-7-yl)methoxy]ethyl acetate is CC(=O)OCCOCn1ccc2c(Cl)nc(Cl)nc21.
What is the InChIKey of 2-[(2,4-dichloropyrrolo[2,3-d]pyrimidin-7-yl)methoxy]ethyl acetate?
The InChIKey is ATERVKPNFRFKQS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11Cl2N3O3/c1-7(17)19-5-4-18-6-16-3-2-8-9(12)14-11(13)15-10(8)16/h2-3H,4-6H2,1H3.
What are the key properties of 2-[(2,4-dichloropyrrolo[2,3-d]pyrimidin-7-yl)methoxy]ethyl acetate?
2-[(2,4-dichloropyrrolo[2,3-d]pyrimidin-7-yl)methoxy]ethyl acetate has a molecular weight of 304.13 g/mol, XLogP of 2.28, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2,4-dichloropyrrolo[2,3-d]pyrimidin-7-yl)methoxy]ethyl acetate is sourced from PubChem (CID 14116872), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).