About 2-[(2,4-dichloropyrrolo[2,3-d]pyrimidin-7-yl)methoxy]ethanol
2-[(2,4-dichloropyrrolo[2,3-d]pyrimidin-7-yl)methoxy]ethanol (PubChem CID 14116873) has the molecular formula C9H9Cl2N3O2
and a molecular weight of 262.10 g/mol. Its IUPAC name is 2-[(2,4-dichloropyrrolo[2,3-d]pyrimidin-7-yl)methoxy]ethanol.
Molecular Properties
| Compound Name | 2-[(2,4-dichloropyrrolo[2,3-d]pyrimidin-7-yl)methoxy]ethanol |
| PubChem CID | 14116873 |
| Molecular Formula | C9H9Cl2N3O2 |
| Molecular Weight | 262.10 g/mol |
| Exact Mass | 261.01 |
| IUPAC Name | 2-[(2,4-dichloropyrrolo[2,3-d]pyrimidin-7-yl)methoxy]ethanol |
| SMILES | OCCOCn1ccc2c(Cl)nc(Cl)nc21 |
| InChI | InChI=1S/C9H9Cl2N3O2/c10-7-6-1-2-14(5-16-4-3-15)8(6)13-9(11)12-7/h1-2,15H,3-5H2 |
| InChIKey | MMIJIINEZUGJNS-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.10 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[(2,4-dichloropyrrolo[2,3-d]pyrimidin-7-yl)methoxy]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2,4-dichloropyrrolo[2,3-d]pyrimidin-7-yl)methoxy]ethanol?
The IUPAC name of 2-[(2,4-dichloropyrrolo[2,3-d]pyrimidin-7-yl)methoxy]ethanol (CID 14116873) is 2-[(2,4-dichloropyrrolo[2,3-d]pyrimidin-7-yl)methoxy]ethanol.
What is the SMILES notation for 2-[(2,4-dichloropyrrolo[2,3-d]pyrimidin-7-yl)methoxy]ethanol?
The canonical SMILES for 2-[(2,4-dichloropyrrolo[2,3-d]pyrimidin-7-yl)methoxy]ethanol is OCCOCn1ccc2c(Cl)nc(Cl)nc21.
What is the InChIKey of 2-[(2,4-dichloropyrrolo[2,3-d]pyrimidin-7-yl)methoxy]ethanol?
The InChIKey is MMIJIINEZUGJNS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9Cl2N3O2/c10-7-6-1-2-14(5-16-4-3-15)8(6)13-9(11)12-7/h1-2,15H,3-5H2.
What are the key properties of 2-[(2,4-dichloropyrrolo[2,3-d]pyrimidin-7-yl)methoxy]ethanol?
2-[(2,4-dichloropyrrolo[2,3-d]pyrimidin-7-yl)methoxy]ethanol has a molecular weight of 262.10 g/mol, XLogP of 1.70, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2,4-dichloropyrrolo[2,3-d]pyrimidin-7-yl)methoxy]ethanol is sourced from PubChem (CID 14116873), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).