C14H14Cl2N2OS — CID 141169178
(3R)-1-[(3,4-dichlorophenyl)-(1,3-thiazol-5-yl)methyl]pyrrolidin-3-ol (PubChem CID 141169178) has the molecular formula C14H14Cl2N2OS and a molecular weight of 329.25 g/mol. Its IUPAC name is (3R)-1-[(3,4-dichlorophenyl)-(1,3-thiazol-5-yl)methyl]pyrrolidin-3-ol.
| Compound Name | (3R)-1-[(3,4-dichlorophenyl)-(1,3-thiazol-5-yl)methyl]pyrrolidin-3-ol |
|---|---|
| PubChem CID | 141169178 |
| Molecular Formula | C14H14Cl2N2OS |
| Molecular Weight | 329.25 g/mol |
| Exact Mass | 328.02 |
| IUPAC Name | (3R)-1-[(3,4-dichlorophenyl)-(1,3-thiazol-5-yl)methyl]pyrrolidin-3-ol |
| SMILES | O[C@@H]1CCN(C(c2ccc(Cl)c(Cl)c2)c2cncs2)C1 |
| InChI | InChI=1S/C14H14Cl2N2OS/c15-11-2-1-9(5-12(11)16)14(13-6-17-8-20-13)18-4-3-10(19)7-18/h1-2,5-6,8,10,14,19H,3-4,7H2/t10-,14?/m1/s1 |
| InChIKey | FJCBEDHTTDHFEH-IAPIXIRKSA-N |
| XLogP | 3.61 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.25 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |