About 5-methoxy-1-methyl-3,6-dihydro-2H-pyridine
5-methoxy-1-methyl-3,6-dihydro-2H-pyridine (PubChem CID 14116970) has the molecular formula C7H13NO
and a molecular weight of 127.19 g/mol. Its IUPAC name is 5-methoxy-1-methyl-3,6-dihydro-2H-pyridine.
Molecular Properties
| Compound Name | 5-methoxy-1-methyl-3,6-dihydro-2H-pyridine |
| PubChem CID | 14116970 |
| Molecular Formula | C7H13NO |
| Molecular Weight | 127.19 g/mol |
| Exact Mass | 127.10 |
| IUPAC Name | 5-methoxy-1-methyl-3,6-dihydro-2H-pyridine |
| SMILES | COC1=CCCN(C)C1 |
| InChI | InChI=1S/C7H13NO/c1-8-5-3-4-7(6-8)9-2/h4H,3,5-6H2,1-2H3 |
| InChIKey | ZVLYIVWDEAHCOQ-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 127.19 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-methoxy-1-methyl-3,6-dihydro-2H-pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methoxy-1-methyl-3,6-dihydro-2H-pyridine?
The IUPAC name of 5-methoxy-1-methyl-3,6-dihydro-2H-pyridine (CID 14116970) is 5-methoxy-1-methyl-3,6-dihydro-2H-pyridine.
What is the SMILES notation for 5-methoxy-1-methyl-3,6-dihydro-2H-pyridine?
The canonical SMILES for 5-methoxy-1-methyl-3,6-dihydro-2H-pyridine is COC1=CCCN(C)C1.
What is the InChIKey of 5-methoxy-1-methyl-3,6-dihydro-2H-pyridine?
The InChIKey is ZVLYIVWDEAHCOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13NO/c1-8-5-3-4-7(6-8)9-2/h4H,3,5-6H2,1-2H3.
What are the key properties of 5-methoxy-1-methyl-3,6-dihydro-2H-pyridine?
5-methoxy-1-methyl-3,6-dihydro-2H-pyridine has a molecular weight of 127.19 g/mol, XLogP of 0.85, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methoxy-1-methyl-3,6-dihydro-2H-pyridine is sourced from PubChem (CID 14116970), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).